About 2-morpholin-4-ylpropyl 8-propan-2-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxylate
2-morpholin-4-ylpropyl 8-propan-2-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxylate (PubChem CID 155449777) has the molecular formula C18H31N3O4
and a molecular weight of 353.46 g/mol. Its IUPAC name is 2-morpholin-4-ylpropyl 8-propan-2-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxylate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylpropyl 8-propan-2-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxylate |
| PubChem CID | 155449777 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | 2-morpholin-4-ylpropyl 8-propan-2-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxylate |
| SMILES | CC(C)N1CCC2(CC1)CC(C(=O)OCC(C)N1CCOCC1)=NO2 |
| InChI | InChI=1S/C18H31N3O4/c1-14(2)20-6-4-18(5-7-20)12-16(19-25-18)17(22)24-13-15(3)21-8-10-23-11-9-21/h14-15H,4-13H2,1-3H3 |
| InChIKey | ZZMVMISHKFPAKB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-morpholin-4-ylpropyl 8-propan-2-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylpropyl 8-propan-2-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxylate?
The IUPAC name of 2-morpholin-4-ylpropyl 8-propan-2-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxylate (CID 155449777) is 2-morpholin-4-ylpropyl 8-propan-2-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxylate.
What is the SMILES notation for 2-morpholin-4-ylpropyl 8-propan-2-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxylate?
The canonical SMILES for 2-morpholin-4-ylpropyl 8-propan-2-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxylate is CC(C)N1CCC2(CC1)CC(C(=O)OCC(C)N1CCOCC1)=NO2.
What is the InChIKey of 2-morpholin-4-ylpropyl 8-propan-2-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxylate?
The InChIKey is ZZMVMISHKFPAKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N3O4/c1-14(2)20-6-4-18(5-7-20)12-16(19-25-18)17(22)24-13-15(3)21-8-10-23-11-9-21/h14-15H,4-13H2,1-3H3.
What are the key properties of 2-morpholin-4-ylpropyl 8-propan-2-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxylate?
2-morpholin-4-ylpropyl 8-propan-2-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxylate has a molecular weight of 353.46 g/mol, XLogP of 1.27, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylpropyl 8-propan-2-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxylate is sourced from PubChem (CID 155449777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).