C25H24N4O2S2 — CID 155449804
5-[[5-(5,5-dimethylbenzo[b][1,8]naphthyridin-10-yl)thiophen-2-yl]methyl]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 155449804) has the molecular formula C25H24N4O2S2 and a molecular weight of 476.63 g/mol. Its IUPAC name is 5-[[5-(5,5-dimethylbenzo[b][1,8]naphthyridin-10-yl)thiophen-2-yl]methyl]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[5-(5,5-dimethylbenzo[b][1,8]naphthyridin-10-yl)thiophen-2-yl]methyl]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 155449804 |
| Molecular Formula | C25H24N4O2S2 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 5-[[5-(5,5-dimethylbenzo[b][1,8]naphthyridin-10-yl)thiophen-2-yl]methyl]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CN1C(=O)C(Cc2ccc(N3c4ccccc4C(C)(C)c4cccnc43)s2)C(=O)N(C)C1=S |
| InChI | InChI=1S/C25H24N4O2S2/c1-25(2)17-8-5-6-10-19(17)29(21-18(25)9-7-13-26-21)20-12-11-15(33-20)14-16-22(30)27(3)24(32)28(4)23(16)31/h5-13,16H,14H2,1-4H3 |
| InChIKey | HQRLPFOCNJPIBU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|