C36H38N8O6S — CID 155449812
2-[(2S)-2-[[2-[[(2R)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 155449812) has the molecular formula C36H38N8O6S and a molecular weight of 710.82 g/mol. Its IUPAC name is 2-[(2S)-2-[[2-[[(2R)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[(2S)-2-[[2-[[(2R)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 155449812 |
| Molecular Formula | C36H38N8O6S |
| Molecular Weight | 710.82 g/mol |
| Exact Mass | 710.26 |
| IUPAC Name | 2-[(2S)-2-[[2-[[(2R)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)c1nc2ccc(C(=O)O)cc2s1 |
| InChI | InChI=1S/C36H38N8O6S/c1-20(45)41-29(17-23-19-40-25-11-6-5-10-24(23)25)33(48)43-28(16-21-8-3-2-4-9-21)32(47)42-27(12-7-15-39-36(37)38)31(46)34-44-26-14-13-22(35(49)50)18-30(26)51-34/h2-6,8-11,13-14,18-19,27-29,40H,7,12,15-17H2,1H3,(H,41,45)(H,42,47)(H,43,48)(H,49,50)(H4,37,38,39)/t27-,28?,29+/m0/s1 |
| InChIKey | YGCQKAYJPZWLGL-ATQGWHGASA-N |
| XLogP | 2.67 |
| TPSA | 234.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.82 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|