About (3-methyl-7-oxooctyl) acetate
(3-methyl-7-oxooctyl) acetate (PubChem CID 15544991) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is (3-methyl-7-oxooctyl) acetate.
Molecular Properties
| Compound Name | (3-methyl-7-oxooctyl) acetate |
| PubChem CID | 15544991 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (3-methyl-7-oxooctyl) acetate |
| SMILES | CC(=O)CCCC(C)CCOC(C)=O |
| InChI | InChI=1S/C11H20O3/c1-9(5-4-6-10(2)12)7-8-14-11(3)13/h9H,4-8H2,1-3H3 |
| InChIKey | MPQXJCFWOBCYSN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methyl-7-oxooctyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-7-oxooctyl) acetate?
The IUPAC name of (3-methyl-7-oxooctyl) acetate (CID 15544991) is (3-methyl-7-oxooctyl) acetate.
What is the SMILES notation for (3-methyl-7-oxooctyl) acetate?
The canonical SMILES for (3-methyl-7-oxooctyl) acetate is CC(=O)CCCC(C)CCOC(C)=O.
What is the InChIKey of (3-methyl-7-oxooctyl) acetate?
The InChIKey is MPQXJCFWOBCYSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-9(5-4-6-10(2)12)7-8-14-11(3)13/h9H,4-8H2,1-3H3.
What are the key properties of (3-methyl-7-oxooctyl) acetate?
(3-methyl-7-oxooctyl) acetate has a molecular weight of 200.28 g/mol, XLogP of 2.34, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-7-oxooctyl) acetate is sourced from PubChem (CID 15544991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).