C12H22N4O3 — CID 155450064
13-amino-5-methyl-1,4,8-triazacyclotetradecane-3,7,14-trione (PubChem CID 155450064) has the molecular formula C12H22N4O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 13-amino-5-methyl-1,4,8-triazacyclotetradecane-3,7,14-trione.
| Compound Name | 13-amino-5-methyl-1,4,8-triazacyclotetradecane-3,7,14-trione |
|---|---|
| PubChem CID | 155450064 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 13-amino-5-methyl-1,4,8-triazacyclotetradecane-3,7,14-trione |
| SMILES | CC1CC(=O)NCCCCC(N)C(=O)NCC(=O)N1 |
| InChI | InChI=1S/C12H22N4O3/c1-8-6-10(17)14-5-3-2-4-9(13)12(19)15-7-11(18)16-8/h8-9H,2-7,13H2,1H3,(H,14,17)(H,15,19)(H,16,18) |
| InChIKey | OBPIOZHCXQNQJO-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |