C35H38N8O4S — CID 155450091
2-[[(2R)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-N-[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-phenylpropanamide (PubChem CID 155450091) has the molecular formula C35H38N8O4S and a molecular weight of 666.81 g/mol. Its IUPAC name is 2-[[(2R)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-N-[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-phenylpropanamide.
| Compound Name | 2-[[(2R)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-N-[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 155450091 |
| Molecular Formula | C35H38N8O4S |
| Molecular Weight | 666.81 g/mol |
| Exact Mass | 666.27 |
| IUPAC Name | 2-[[(2R)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-N-[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-phenylpropanamide |
| SMILES | CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C35H38N8O4S/c1-21(44)40-29(19-23-20-39-25-13-6-5-12-24(23)25)33(47)42-28(18-22-10-3-2-4-11-22)32(46)41-27(15-9-17-38-35(36)37)31(45)34-43-26-14-7-8-16-30(26)48-34/h2-8,10-14,16,20,27-29,39H,9,15,17-19H2,1H3,(H,40,44)(H,41,46)(H,42,47)(H4,36,37,38)/t27-,28?,29+/m0/s1 |
| InChIKey | GQPZGFPDQGUEBC-ATQGWHGASA-N |
| XLogP | 2.97 |
| TPSA | 197.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.81 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|