About 2-bromo-1-[(2R,6S)-2,6-dimethyloxan-4-yl]ethanone
2-bromo-1-[(2R,6S)-2,6-dimethyloxan-4-yl]ethanone (PubChem CID 155450938) has the molecular formula C9H15BrO2
and a molecular weight of 235.12 g/mol. Its IUPAC name is 2-bromo-1-[(2R,6S)-2,6-dimethyloxan-4-yl]ethanone.
Molecular Properties
| Compound Name | 2-bromo-1-[(2R,6S)-2,6-dimethyloxan-4-yl]ethanone |
| PubChem CID | 155450938 |
| Molecular Formula | C9H15BrO2 |
| Molecular Weight | 235.12 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2-bromo-1-[(2R,6S)-2,6-dimethyloxan-4-yl]ethanone |
| SMILES | C[C@@H]1CC(C(=O)CBr)C[C@H](C)O1 |
| InChI | InChI=1S/C9H15BrO2/c1-6-3-8(9(11)5-10)4-7(2)12-6/h6-8H,3-5H2,1-2H3/t6-,7+,8? |
| InChIKey | XZOUXJBFDBOCIS-DHBOJHSNSA-N |
| XLogP | 2.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-[(2R,6S)-2,6-dimethyloxan-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-[(2R,6S)-2,6-dimethyloxan-4-yl]ethanone?
The IUPAC name of 2-bromo-1-[(2R,6S)-2,6-dimethyloxan-4-yl]ethanone (CID 155450938) is 2-bromo-1-[(2R,6S)-2,6-dimethyloxan-4-yl]ethanone.
What is the SMILES notation for 2-bromo-1-[(2R,6S)-2,6-dimethyloxan-4-yl]ethanone?
The canonical SMILES for 2-bromo-1-[(2R,6S)-2,6-dimethyloxan-4-yl]ethanone is C[C@@H]1CC(C(=O)CBr)C[C@H](C)O1.
What is the InChIKey of 2-bromo-1-[(2R,6S)-2,6-dimethyloxan-4-yl]ethanone?
The InChIKey is XZOUXJBFDBOCIS-DHBOJHSNSA-N. The full InChI is InChI=1S/C9H15BrO2/c1-6-3-8(9(11)5-10)4-7(2)12-6/h6-8H,3-5H2,1-2H3/t6-,7+,8?.
What are the key properties of 2-bromo-1-[(2R,6S)-2,6-dimethyloxan-4-yl]ethanone?
2-bromo-1-[(2R,6S)-2,6-dimethyloxan-4-yl]ethanone has a molecular weight of 235.12 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-[(2R,6S)-2,6-dimethyloxan-4-yl]ethanone is sourced from PubChem (CID 155450938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).