About 2-[5-[[4-[(2,6-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]-2-pyridinyl]propan-2-ol
2-[5-[[4-[(2,6-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]-2-pyridinyl]propan-2-ol (PubChem CID 155451167) has the molecular formula C20H22N4O2
and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-[5-[[4-[(2,6-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]-2-pyridinyl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[5-[[4-[(2,6-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]-2-pyridinyl]propan-2-ol |
| PubChem CID | 155451167 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-[5-[[4-[(2,6-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]-2-pyridinyl]propan-2-ol |
| SMILES | Cc1ccc(Oc2ccnc(Nc3ccc(C(C)(C)O)nc3)c2)c(C)n1 |
| InChI | InChI=1S/C20H22N4O2/c1-13-5-7-17(14(2)23-13)26-16-9-10-21-19(11-16)24-15-6-8-18(22-12-15)20(3,4)25/h5-12,25H,1-4H3,(H,21,24) |
| InChIKey | AIGYCXLKENHFKH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-[[4-[(2,6-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]-2-pyridinyl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[[4-[(2,6-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]-2-pyridinyl]propan-2-ol?
The IUPAC name of 2-[5-[[4-[(2,6-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]-2-pyridinyl]propan-2-ol (CID 155451167) is 2-[5-[[4-[(2,6-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]-2-pyridinyl]propan-2-ol.
What is the SMILES notation for 2-[5-[[4-[(2,6-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]-2-pyridinyl]propan-2-ol?
The canonical SMILES for 2-[5-[[4-[(2,6-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]-2-pyridinyl]propan-2-ol is Cc1ccc(Oc2ccnc(Nc3ccc(C(C)(C)O)nc3)c2)c(C)n1.
What is the InChIKey of 2-[5-[[4-[(2,6-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]-2-pyridinyl]propan-2-ol?
The InChIKey is AIGYCXLKENHFKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O2/c1-13-5-7-17(14(2)23-13)26-16-9-10-21-19(11-16)24-15-6-8-18(22-12-15)20(3,4)25/h5-12,25H,1-4H3,(H,21,24).
What are the key properties of 2-[5-[[4-[(2,6-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]-2-pyridinyl]propan-2-ol?
2-[5-[[4-[(2,6-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]-2-pyridinyl]propan-2-ol has a molecular weight of 350.42 g/mol, XLogP of 4.25, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[[4-[(2,6-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]-2-pyridinyl]propan-2-ol is sourced from PubChem (CID 155451167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).