C18H22N6O2 — CID 155451536
2-amino-4-[(8-hydroxy-8-methyl-6,7-dihydro-5H-quinolin-2-yl)amino]-N-prop-2-enylpyrimidine-5-carboxamide (PubChem CID 155451536) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-amino-4-[(8-hydroxy-8-methyl-6,7-dihydro-5H-quinolin-2-yl)amino]-N-prop-2-enylpyrimidine-5-carboxamide.
| Compound Name | 2-amino-4-[(8-hydroxy-8-methyl-6,7-dihydro-5H-quinolin-2-yl)amino]-N-prop-2-enylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155451536 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-amino-4-[(8-hydroxy-8-methyl-6,7-dihydro-5H-quinolin-2-yl)amino]-N-prop-2-enylpyrimidine-5-carboxamide |
| SMILES | C=CCNC(=O)c1cnc(N)nc1Nc1ccc2c(n1)C(C)(O)CCC2 |
| InChI | InChI=1S/C18H22N6O2/c1-3-9-20-16(25)12-10-21-17(19)24-15(12)23-13-7-6-11-5-4-8-18(2,26)14(11)22-13/h3,6-7,10,26H,1,4-5,8-9H2,2H3,(H,20,25)(H3,19,21,22,23,24) |
| InChIKey | BBCOIPWQBBMYKO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|