About 1-[4-chloro-2-(furan-2-ylmethylamino)phenyl]-2,2,2-trifluoroethanol
1-[4-chloro-2-(furan-2-ylmethylamino)phenyl]-2,2,2-trifluoroethanol (PubChem CID 155451950) has the molecular formula C13H11ClF3NO2
and a molecular weight of 305.68 g/mol. Its IUPAC name is 1-[4-chloro-2-(furan-2-ylmethylamino)phenyl]-2,2,2-trifluoroethanol.
Molecular Properties
| Compound Name | 1-[4-chloro-2-(furan-2-ylmethylamino)phenyl]-2,2,2-trifluoroethanol |
| PubChem CID | 155451950 |
| Molecular Formula | C13H11ClF3NO2 |
| Molecular Weight | 305.68 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 1-[4-chloro-2-(furan-2-ylmethylamino)phenyl]-2,2,2-trifluoroethanol |
| SMILES | OC(c1ccc(Cl)cc1NCc1ccco1)C(F)(F)F |
| InChI | InChI=1S/C13H11ClF3NO2/c14-8-3-4-10(12(19)13(15,16)17)11(6-8)18-7-9-2-1-5-20-9/h1-6,12,18-19H,7H2 |
| InChIKey | ITKWRIQRJZKABJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.68 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-chloro-2-(furan-2-ylmethylamino)phenyl]-2,2,2-trifluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-chloro-2-(furan-2-ylmethylamino)phenyl]-2,2,2-trifluoroethanol?
The IUPAC name of 1-[4-chloro-2-(furan-2-ylmethylamino)phenyl]-2,2,2-trifluoroethanol (CID 155451950) is 1-[4-chloro-2-(furan-2-ylmethylamino)phenyl]-2,2,2-trifluoroethanol.
What is the SMILES notation for 1-[4-chloro-2-(furan-2-ylmethylamino)phenyl]-2,2,2-trifluoroethanol?
The canonical SMILES for 1-[4-chloro-2-(furan-2-ylmethylamino)phenyl]-2,2,2-trifluoroethanol is OC(c1ccc(Cl)cc1NCc1ccco1)C(F)(F)F.
What is the InChIKey of 1-[4-chloro-2-(furan-2-ylmethylamino)phenyl]-2,2,2-trifluoroethanol?
The InChIKey is ITKWRIQRJZKABJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClF3NO2/c14-8-3-4-10(12(19)13(15,16)17)11(6-8)18-7-9-2-1-5-20-9/h1-6,12,18-19H,7H2.
What are the key properties of 1-[4-chloro-2-(furan-2-ylmethylamino)phenyl]-2,2,2-trifluoroethanol?
1-[4-chloro-2-(furan-2-ylmethylamino)phenyl]-2,2,2-trifluoroethanol has a molecular weight of 305.68 g/mol, XLogP of 4.14, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-chloro-2-(furan-2-ylmethylamino)phenyl]-2,2,2-trifluoroethanol is sourced from PubChem (CID 155451950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).