C24H22Br2N4O5 — CID 155453149
[4-[(4S)-8,9-dibromo-1-methyl-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepin-4-yl]-2-oxobutoxy]methyl methyl carbonate (PubChem CID 155453149) has the molecular formula C24H22Br2N4O5 and a molecular weight of 606.27 g/mol. Its IUPAC name is [4-[(4S)-8,9-dibromo-1-methyl-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepin-4-yl]-2-oxobutoxy]methyl methyl carbonate.
| Compound Name | [4-[(4S)-8,9-dibromo-1-methyl-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepin-4-yl]-2-oxobutoxy]methyl methyl carbonate |
|---|---|
| PubChem CID | 155453149 |
| Molecular Formula | C24H22Br2N4O5 |
| Molecular Weight | 606.27 g/mol |
| Exact Mass | 604.00 |
| IUPAC Name | [4-[(4S)-8,9-dibromo-1-methyl-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepin-4-yl]-2-oxobutoxy]methyl methyl carbonate |
| SMILES | COC(=O)OCOCC(=O)CC[C@@H]1N=C(c2ccccn2)c2cc(Br)c(Br)cc2-n2c(C)cnc21 |
| InChI | InChI=1S/C24H22Br2N4O5/c1-14-11-28-23-20(7-6-15(31)12-34-13-35-24(32)33-2)29-22(19-5-3-4-8-27-19)16-9-17(25)18(26)10-21(16)30(14)23/h3-5,8-11,20H,6-7,12-13H2,1-2H3/t20-/m0/s1 |
| InChIKey | AKQYHBIDIWCTCW-FQEVSTJZSA-N |
| XLogP | 5.10 |
| TPSA | 104.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.27 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|