C25H30O — CID 155453180
(1S,9R,10R)-17-benzyl-4-methoxytetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 155453180) has the molecular formula C25H30O and a molecular weight of 346.51 g/mol. Its IUPAC name is (1S,9R,10R)-17-benzyl-4-methoxytetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (1S,9R,10R)-17-benzyl-4-methoxytetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 155453180 |
| Molecular Formula | C25H30O |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (1S,9R,10R)-17-benzyl-4-methoxytetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | COc1ccc2c(c1)[C@]13CCCC[C@@H]1[C@H](C2)C(Cc1ccccc1)CC3 |
| InChI | InChI=1S/C25H30O/c1-26-21-11-10-20-16-22-19(15-18-7-3-2-4-8-18)12-14-25(24(20)17-21)13-6-5-9-23(22)25/h2-4,7-8,10-11,17,19,22-23H,5-6,9,12-16H2,1H3/t19?,22-,23-,25+/m1/s1 |
| InChIKey | GABRFHNBBUWWLL-HUBDRVEFSA-N |
| XLogP | 5.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |