3-bromo-5-fluoropyridine-2-carbonyl chloride

C6H2BrClFNO — CID 155453576

IUPAC3-bromo-5-fluoropyridine-2-carbonyl chloride
SMILESO=C(Cl)c1ncc(F)cc1Br
InChIInChI=1S/C6H2BrClFNO/c7-4-1-3(9)2-10-5(4)6(8)11/h1-2H
InChIKeyXUCHRQKGBWKENW-UHFFFAOYSA-N
MW238.44 g/mol
LogP2.36
Rot. Bonds1

About 3-bromo-5-fluoropyridine-2-carbonyl chloride

3-bromo-5-fluoropyridine-2-carbonyl chloride (PubChem CID 155453576) has the molecular formula C6H2BrClFNO and a molecular weight of 238.44 g/mol. Its IUPAC name is 3-bromo-5-fluoropyridine-2-carbonyl chloride.

Molecular Properties

Compound Name3-bromo-5-fluoropyridine-2-carbonyl chloride
PubChem CID155453576
Molecular FormulaC6H2BrClFNO
Molecular Weight238.44 g/mol
Exact Mass236.90
IUPAC Name3-bromo-5-fluoropyridine-2-carbonyl chloride
SMILESO=C(Cl)c1ncc(F)cc1Br
InChIInChI=1S/C6H2BrClFNO/c7-4-1-3(9)2-10-5(4)6(8)11/h1-2H
InChIKeyXUCHRQKGBWKENW-UHFFFAOYSA-N
XLogP2.36
TPSA29.96 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.44
LogP ≤ 52.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 3-bromo-5-fluoropyridine-2-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-5-fluoropyridine-2-carbonyl chloride?
The IUPAC name of 3-bromo-5-fluoropyridine-2-carbonyl chloride (CID 155453576) is 3-bromo-5-fluoropyridine-2-carbonyl chloride.
What is the SMILES notation for 3-bromo-5-fluoropyridine-2-carbonyl chloride?
The canonical SMILES for 3-bromo-5-fluoropyridine-2-carbonyl chloride is O=C(Cl)c1ncc(F)cc1Br.
What is the InChIKey of 3-bromo-5-fluoropyridine-2-carbonyl chloride?
The InChIKey is XUCHRQKGBWKENW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BrClFNO/c7-4-1-3(9)2-10-5(4)6(8)11/h1-2H.
What are the key properties of 3-bromo-5-fluoropyridine-2-carbonyl chloride?
3-bromo-5-fluoropyridine-2-carbonyl chloride has a molecular weight of 238.44 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-fluoropyridine-2-carbonyl chloride is sourced from PubChem (CID 155453576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).