About 3-[2-(2,5-dimethylphenyl)ethynyl]imidazo[1,2-a]pyridine
3-[2-(2,5-dimethylphenyl)ethynyl]imidazo[1,2-a]pyridine (PubChem CID 155453754) has the molecular formula C17H14N2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-[2-(2,5-dimethylphenyl)ethynyl]imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 3-[2-(2,5-dimethylphenyl)ethynyl]imidazo[1,2-a]pyridine |
| PubChem CID | 155453754 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-[2-(2,5-dimethylphenyl)ethynyl]imidazo[1,2-a]pyridine |
| SMILES | Cc1ccc(C)c(C#Cc2cnc3ccccn23)c1 |
| InChI | InChI=1S/C17H14N2/c1-13-6-7-14(2)15(11-13)8-9-16-12-18-17-5-3-4-10-19(16)17/h3-7,10-12H,1-2H3 |
| InChIKey | MLNZTJYYIFDDNF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2,5-dimethylphenyl)ethynyl]imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,5-dimethylphenyl)ethynyl]imidazo[1,2-a]pyridine?
The IUPAC name of 3-[2-(2,5-dimethylphenyl)ethynyl]imidazo[1,2-a]pyridine (CID 155453754) is 3-[2-(2,5-dimethylphenyl)ethynyl]imidazo[1,2-a]pyridine.
What is the SMILES notation for 3-[2-(2,5-dimethylphenyl)ethynyl]imidazo[1,2-a]pyridine?
The canonical SMILES for 3-[2-(2,5-dimethylphenyl)ethynyl]imidazo[1,2-a]pyridine is Cc1ccc(C)c(C#Cc2cnc3ccccn23)c1.
What is the InChIKey of 3-[2-(2,5-dimethylphenyl)ethynyl]imidazo[1,2-a]pyridine?
The InChIKey is MLNZTJYYIFDDNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2/c1-13-6-7-14(2)15(11-13)8-9-16-12-18-17-5-3-4-10-19(16)17/h3-7,10-12H,1-2H3.
What are the key properties of 3-[2-(2,5-dimethylphenyl)ethynyl]imidazo[1,2-a]pyridine?
3-[2-(2,5-dimethylphenyl)ethynyl]imidazo[1,2-a]pyridine has a molecular weight of 246.31 g/mol, XLogP of 3.35, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,5-dimethylphenyl)ethynyl]imidazo[1,2-a]pyridine is sourced from PubChem (CID 155453754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).