C10H17F3N2 — CID 155453758
(2Z)-5-methyl-2-(2,2,2-trifluoroethyl)-4,5,6,7,8,9-hexahydro-1H-1,4-diazonine (PubChem CID 155453758) has the molecular formula C10H17F3N2 and a molecular weight of 222.25 g/mol. Its IUPAC name is (2Z)-5-methyl-2-(2,2,2-trifluoroethyl)-4,5,6,7,8,9-hexahydro-1H-1,4-diazonine.
| Compound Name | (2Z)-5-methyl-2-(2,2,2-trifluoroethyl)-4,5,6,7,8,9-hexahydro-1H-1,4-diazonine |
|---|---|
| PubChem CID | 155453758 |
| Molecular Formula | C10H17F3N2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (2Z)-5-methyl-2-(2,2,2-trifluoroethyl)-4,5,6,7,8,9-hexahydro-1H-1,4-diazonine |
| SMILES | CC1CCCCN/C(CC(F)(F)F)=C\N1 |
| InChI | InChI=1S/C10H17F3N2/c1-8-4-2-3-5-14-9(7-15-8)6-10(11,12)13/h7-8,14-15H,2-6H2,1H3/b9-7- |
| InChIKey | FVZJNHRKWYJBLJ-CLFYSBASSA-N |
| XLogP | 2.53 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |