About (3S)-3-fluoro-N,N-dipropyl-2,3-dihydropyridin-4-amine
(3S)-3-fluoro-N,N-dipropyl-2,3-dihydropyridin-4-amine (PubChem CID 155454735) has the molecular formula C11H19FN2
and a molecular weight of 198.28 g/mol. Its IUPAC name is (3S)-3-fluoro-N,N-dipropyl-2,3-dihydropyridin-4-amine.
Molecular Properties
| Compound Name | (3S)-3-fluoro-N,N-dipropyl-2,3-dihydropyridin-4-amine |
| PubChem CID | 155454735 |
| Molecular Formula | C11H19FN2 |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | (3S)-3-fluoro-N,N-dipropyl-2,3-dihydropyridin-4-amine |
| SMILES | CCCN(CCC)C1=CC=NC[C@@H]1F |
| InChI | InChI=1S/C11H19FN2/c1-3-7-14(8-4-2)11-5-6-13-9-10(11)12/h5-6,10H,3-4,7-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | HCWSEGZUJAKFAR-JTQLQIEISA-N |
| XLogP | 2.41 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-fluoro-N,N-dipropyl-2,3-dihydropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-fluoro-N,N-dipropyl-2,3-dihydropyridin-4-amine?
The IUPAC name of (3S)-3-fluoro-N,N-dipropyl-2,3-dihydropyridin-4-amine (CID 155454735) is (3S)-3-fluoro-N,N-dipropyl-2,3-dihydropyridin-4-amine.
What is the SMILES notation for (3S)-3-fluoro-N,N-dipropyl-2,3-dihydropyridin-4-amine?
The canonical SMILES for (3S)-3-fluoro-N,N-dipropyl-2,3-dihydropyridin-4-amine is CCCN(CCC)C1=CC=NC[C@@H]1F.
What is the InChIKey of (3S)-3-fluoro-N,N-dipropyl-2,3-dihydropyridin-4-amine?
The InChIKey is HCWSEGZUJAKFAR-JTQLQIEISA-N. The full InChI is InChI=1S/C11H19FN2/c1-3-7-14(8-4-2)11-5-6-13-9-10(11)12/h5-6,10H,3-4,7-9H2,1-2H3/t10-/m0/s1.
What are the key properties of (3S)-3-fluoro-N,N-dipropyl-2,3-dihydropyridin-4-amine?
(3S)-3-fluoro-N,N-dipropyl-2,3-dihydropyridin-4-amine has a molecular weight of 198.28 g/mol, XLogP of 2.41, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-fluoro-N,N-dipropyl-2,3-dihydropyridin-4-amine is sourced from PubChem (CID 155454735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).