About (1-ethoxy-3,3-difluoroprop-2-enyl)sulfanylbenzene
(1-ethoxy-3,3-difluoroprop-2-enyl)sulfanylbenzene (PubChem CID 15545475) has the molecular formula C11H12F2OS
and a molecular weight of 230.28 g/mol. Its IUPAC name is (1-ethoxy-3,3-difluoroprop-2-enyl)sulfanylbenzene.
Molecular Properties
| Compound Name | (1-ethoxy-3,3-difluoroprop-2-enyl)sulfanylbenzene |
| PubChem CID | 15545475 |
| Molecular Formula | C11H12F2OS |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | (1-ethoxy-3,3-difluoroprop-2-enyl)sulfanylbenzene |
| SMILES | CCOC(C=C(F)F)Sc1ccccc1 |
| InChI | InChI=1S/C11H12F2OS/c1-2-14-11(8-10(12)13)15-9-6-4-3-5-7-9/h3-8,11H,2H2,1H3 |
| InChIKey | PUYYFTGPUXCYHJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1-ethoxy-3,3-difluoroprop-2-enyl)sulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethoxy-3,3-difluoroprop-2-enyl)sulfanylbenzene?
The IUPAC name of (1-ethoxy-3,3-difluoroprop-2-enyl)sulfanylbenzene (CID 15545475) is (1-ethoxy-3,3-difluoroprop-2-enyl)sulfanylbenzene.
What is the SMILES notation for (1-ethoxy-3,3-difluoroprop-2-enyl)sulfanylbenzene?
The canonical SMILES for (1-ethoxy-3,3-difluoroprop-2-enyl)sulfanylbenzene is CCOC(C=C(F)F)Sc1ccccc1.
What is the InChIKey of (1-ethoxy-3,3-difluoroprop-2-enyl)sulfanylbenzene?
The InChIKey is PUYYFTGPUXCYHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2OS/c1-2-14-11(8-10(12)13)15-9-6-4-3-5-7-9/h3-8,11H,2H2,1H3.
What are the key properties of (1-ethoxy-3,3-difluoroprop-2-enyl)sulfanylbenzene?
(1-ethoxy-3,3-difluoroprop-2-enyl)sulfanylbenzene has a molecular weight of 230.28 g/mol, XLogP of 3.92, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethoxy-3,3-difluoroprop-2-enyl)sulfanylbenzene is sourced from PubChem (CID 15545475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).