C25H35FN2 — CID 155454859
1-[4-(3-ethylphenyl)but-1-en-2-yl]-4-[(2E,4E,6E)-3-fluoronona-2,4,6-trien-4-yl]piperazine (PubChem CID 155454859) has the molecular formula C25H35FN2 and a molecular weight of 382.57 g/mol. Its IUPAC name is 1-[4-(3-ethylphenyl)but-1-en-2-yl]-4-[(2E,4E,6E)-3-fluoronona-2,4,6-trien-4-yl]piperazine.
| Compound Name | 1-[4-(3-ethylphenyl)but-1-en-2-yl]-4-[(2E,4E,6E)-3-fluoronona-2,4,6-trien-4-yl]piperazine |
|---|---|
| PubChem CID | 155454859 |
| Molecular Formula | C25H35FN2 |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | 1-[4-(3-ethylphenyl)but-1-en-2-yl]-4-[(2E,4E,6E)-3-fluoronona-2,4,6-trien-4-yl]piperazine |
| SMILES | C=C(CCc1cccc(CC)c1)N1CCN(C(=C/C=C/CC)/C(F)=C\C)CC1 |
| InChI | InChI=1S/C25H35FN2/c1-5-8-9-13-25(24(26)7-3)28-18-16-27(17-19-28)21(4)14-15-23-12-10-11-22(6-2)20-23/h7-13,20H,4-6,14-19H2,1-3H3/b9-8+,24-7+,25-13+ |
| InChIKey | DDAODPRJDKCFFY-MWYOFLFJSA-N |
| XLogP | 6.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|