C17H24ClFN4O2 — CID 155454964
tert-butyl (3aR,6aS)-2-(2-chloro-5-fluoropyrimidin-4-yl)-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 155454964) has the molecular formula C17H24ClFN4O2 and a molecular weight of 370.86 g/mol. Its IUPAC name is tert-butyl (3aR,6aS)-2-(2-chloro-5-fluoropyrimidin-4-yl)-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aR,6aS)-2-(2-chloro-5-fluoropyrimidin-4-yl)-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 155454964 |
| Molecular Formula | C17H24ClFN4O2 |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | tert-butyl (3aR,6aS)-2-(2-chloro-5-fluoropyrimidin-4-yl)-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@]2(C)CN(c3nc(Cl)ncc3F)C[C@@]2(C)C1 |
| InChI | InChI=1S/C17H24ClFN4O2/c1-15(2,3)25-14(24)23-9-16(4)7-22(8-17(16,5)10-23)12-11(19)6-20-13(18)21-12/h6H,7-10H2,1-5H3/t16-,17+ |
| InChIKey | WUVWRIGAXWLESM-CALCHBBNSA-N |
| XLogP | 3.35 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |