C22H28N2O6 — CID 155455072
5-methyl-1-[2-methyl-4-(3-methyl-2H-indazol-5-yl)phenoxy]hexane-1,2,3,4,6-pentol (PubChem CID 155455072) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is 5-methyl-1-[2-methyl-4-(3-methyl-2H-indazol-5-yl)phenoxy]hexane-1,2,3,4,6-pentol.
| Compound Name | 5-methyl-1-[2-methyl-4-(3-methyl-2H-indazol-5-yl)phenoxy]hexane-1,2,3,4,6-pentol |
|---|---|
| PubChem CID | 155455072 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 5-methyl-1-[2-methyl-4-(3-methyl-2H-indazol-5-yl)phenoxy]hexane-1,2,3,4,6-pentol |
| SMILES | Cc1cc(-c2ccc3n[nH]c(C)c3c2)ccc1OC(O)C(O)C(O)C(O)C(C)CO |
| InChI | InChI=1S/C22H28N2O6/c1-11-8-14(15-4-6-17-16(9-15)13(3)23-24-17)5-7-18(11)30-22(29)21(28)20(27)19(26)12(2)10-25/h4-9,12,19-22,25-29H,10H2,1-3H3,(H,23,24) |
| InChIKey | KIHROJKJXSTWJW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 139.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|