C18H22F3N7O — CID 155455293
1-[3a,6a-dimethyl-2-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-2,2,2-trifluoroethanone (PubChem CID 155455293) has the molecular formula C18H22F3N7O and a molecular weight of 409.42 g/mol. Its IUPAC name is 1-[3a,6a-dimethyl-2-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[3a,6a-dimethyl-2-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 155455293 |
| Molecular Formula | C18H22F3N7O |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 1-[3a,6a-dimethyl-2-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-2,2,2-trifluoroethanone |
| SMILES | Cn1cc(Nc2nccc(N3CC4(C)CN(C(=O)C(F)(F)F)CC4(C)C3)n2)cn1 |
| InChI | InChI=1S/C18H22F3N7O/c1-16-8-27(9-17(16,2)11-28(10-16)14(29)18(19,20)21)13-4-5-22-15(25-13)24-12-6-23-26(3)7-12/h4-7H,8-11H2,1-3H3,(H,22,24,25) |
| InChIKey | KYYGHRNDGIPZQD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |