C15H20ClFN4O2 — CID 155455295
tert-butyl (3aR,6aS)-2-(2-chloro-5-fluoropyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 155455295) has the molecular formula C15H20ClFN4O2 and a molecular weight of 342.80 g/mol. Its IUPAC name is tert-butyl (3aR,6aS)-2-(2-chloro-5-fluoropyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aR,6aS)-2-(2-chloro-5-fluoropyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 155455295 |
| Molecular Formula | C15H20ClFN4O2 |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | tert-butyl (3aR,6aS)-2-(2-chloro-5-fluoropyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CN(c3nc(Cl)ncc3F)C[C@@H]2C1 |
| InChI | InChI=1S/C15H20ClFN4O2/c1-15(2,3)23-14(22)21-7-9-5-20(6-10(9)8-21)12-11(17)4-18-13(16)19-12/h4,9-10H,5-8H2,1-3H3/t9-,10+ |
| InChIKey | RXSHSOSLCUDMSG-AOOOYVTPSA-N |
| XLogP | 2.57 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |