C11H18O — CID 155455525
(2R,3R)-2,3,5-trimethyl-6-prop-2-enyl-3,6-dihydro-2H-pyran (PubChem CID 155455525) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (2R,3R)-2,3,5-trimethyl-6-prop-2-enyl-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3R)-2,3,5-trimethyl-6-prop-2-enyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 155455525 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (2R,3R)-2,3,5-trimethyl-6-prop-2-enyl-3,6-dihydro-2H-pyran |
| SMILES | C=CCC1O[C@H](C)[C@H](C)C=C1C |
| InChI | InChI=1S/C11H18O/c1-5-6-11-9(3)7-8(2)10(4)12-11/h5,7-8,10-11H,1,6H2,2-4H3/t8-,10-,11?/m1/s1 |
| InChIKey | OJLOHDIJGDAGPG-TZIJJQLOSA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|