C15H10F7NS — CID 155455528
1-[2-amino-3,5,6-trifluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenyl]ethanethiol (PubChem CID 155455528) has the molecular formula C15H10F7NS and a molecular weight of 369.31 g/mol. Its IUPAC name is 1-[2-amino-3,5,6-trifluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenyl]ethanethiol.
| Compound Name | 1-[2-amino-3,5,6-trifluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenyl]ethanethiol |
|---|---|
| PubChem CID | 155455528 |
| Molecular Formula | C15H10F7NS |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 1-[2-amino-3,5,6-trifluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenyl]ethanethiol |
| SMILES | Cc1c(F)c(F)c(-c2c(F)c(N)c(C(C)S)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C15H10F7NS/c1-3-8(16)11(19)6(12(20)9(3)17)7-13(21)10(18)5(4(2)24)15(23)14(7)22/h4,24H,23H2,1-2H3 |
| InChIKey | YVTOGFWQCOVDSV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|