C15H28N2 — CID 155455534
(Z)-1-[[(2Z)-2-ethylidene-4,4-dimethylpentylidene]amino]-3,3-dimethylbut-1-en-2-amine (PubChem CID 155455534) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is (Z)-1-[[(2Z)-2-ethylidene-4,4-dimethylpentylidene]amino]-3,3-dimethylbut-1-en-2-amine.
| Compound Name | (Z)-1-[[(2Z)-2-ethylidene-4,4-dimethylpentylidene]amino]-3,3-dimethylbut-1-en-2-amine |
|---|---|
| PubChem CID | 155455534 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | (Z)-1-[[(2Z)-2-ethylidene-4,4-dimethylpentylidene]amino]-3,3-dimethylbut-1-en-2-amine |
| SMILES | C/C=C(\C=N\C=C(/N)C(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C15H28N2/c1-8-12(9-14(2,3)4)10-17-11-13(16)15(5,6)7/h8,10-11H,9,16H2,1-7H3/b12-8-,13-11-,17-10+ |
| InChIKey | AKWQXRXBBCBCDX-MSPWZXLESA-N |
| XLogP | 4.29 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|