C12H18O5 — CID 15545582
(1R,2R,6R,8R)-1,4,4-trimethyl-3,5,7,13-tetraoxatricyclo[6.5.0.02,6]tridecan-11-one (PubChem CID 15545582) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (1R,2R,6R,8R)-1,4,4-trimethyl-3,5,7,13-tetraoxatricyclo[6.5.0.02,6]tridecan-11-one.
| Compound Name | (1R,2R,6R,8R)-1,4,4-trimethyl-3,5,7,13-tetraoxatricyclo[6.5.0.02,6]tridecan-11-one |
|---|---|
| PubChem CID | 15545582 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (1R,2R,6R,8R)-1,4,4-trimethyl-3,5,7,13-tetraoxatricyclo[6.5.0.02,6]tridecan-11-one |
| SMILES | CC1(C)O[C@H]2O[C@@H]3CCC(=O)CO[C@@]3(C)[C@H]2O1 |
| InChI | InChI=1S/C12H18O5/c1-11(2)16-9-10(17-11)15-8-5-4-7(13)6-14-12(8,9)3/h8-10H,4-6H2,1-3H3/t8-,9+,10-,12-/m1/s1 |
| InChIKey | JCWDUHSUBWQMKF-DTHBNOIPSA-N |
| XLogP | 1.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |