C9H16N2 — CID 155456337
1,2-dimethyl-4,5,6,7-tetrahydro-3H-indazole (PubChem CID 155456337) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 1,2-dimethyl-4,5,6,7-tetrahydro-3H-indazole.
| Compound Name | 1,2-dimethyl-4,5,6,7-tetrahydro-3H-indazole |
|---|---|
| PubChem CID | 155456337 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1,2-dimethyl-4,5,6,7-tetrahydro-3H-indazole |
| SMILES | CN1CC2=C(CCCC2)N1C |
| InChI | InChI=1S/C9H16N2/c1-10-7-8-5-3-4-6-9(8)11(10)2/h3-7H2,1-2H3 |
| InChIKey | OSPPMKLAIDQZLB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |