About (10Z,13Z)-1-[(3S)-oxolan-3-yl]nonadeca-10,13-dien-2-one
(10Z,13Z)-1-[(3S)-oxolan-3-yl]nonadeca-10,13-dien-2-one (PubChem CID 155456381) has the molecular formula C23H40O2
and a molecular weight of 348.57 g/mol. Its IUPAC name is (10Z,13Z)-1-[(3S)-oxolan-3-yl]nonadeca-10,13-dien-2-one.
Molecular Properties
| Compound Name | (10Z,13Z)-1-[(3S)-oxolan-3-yl]nonadeca-10,13-dien-2-one |
| PubChem CID | 155456381 |
| Molecular Formula | C23H40O2 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.30 |
| IUPAC Name | (10Z,13Z)-1-[(3S)-oxolan-3-yl]nonadeca-10,13-dien-2-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)C[C@@H]1CCOC1 |
| InChI | InChI=1S/C23H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(24)20-22-18-19-25-21-22/h6-7,9-10,22H,2-5,8,11-21H2,1H3/b7-6-,10-9-/t22-/m0/s1 |
| InChIKey | AQFMILBMPLWSRQ-KDTZXJSHSA-N |
| XLogP | 6.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (10Z,13Z)-1-[(3S)-oxolan-3-yl]nonadeca-10,13-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10Z,13Z)-1-[(3S)-oxolan-3-yl]nonadeca-10,13-dien-2-one?
The IUPAC name of (10Z,13Z)-1-[(3S)-oxolan-3-yl]nonadeca-10,13-dien-2-one (CID 155456381) is (10Z,13Z)-1-[(3S)-oxolan-3-yl]nonadeca-10,13-dien-2-one.
What is the SMILES notation for (10Z,13Z)-1-[(3S)-oxolan-3-yl]nonadeca-10,13-dien-2-one?
The canonical SMILES for (10Z,13Z)-1-[(3S)-oxolan-3-yl]nonadeca-10,13-dien-2-one is CCCCC/C=C\C/C=C\CCCCCCCC(=O)C[C@@H]1CCOC1.
What is the InChIKey of (10Z,13Z)-1-[(3S)-oxolan-3-yl]nonadeca-10,13-dien-2-one?
The InChIKey is AQFMILBMPLWSRQ-KDTZXJSHSA-N. The full InChI is InChI=1S/C23H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(24)20-22-18-19-25-21-22/h6-7,9-10,22H,2-5,8,11-21H2,1H3/b7-6-,10-9-/t22-/m0/s1.
What are the key properties of (10Z,13Z)-1-[(3S)-oxolan-3-yl]nonadeca-10,13-dien-2-one?
(10Z,13Z)-1-[(3S)-oxolan-3-yl]nonadeca-10,13-dien-2-one has a molecular weight of 348.57 g/mol, XLogP of 6.80, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (10Z,13Z)-1-[(3S)-oxolan-3-yl]nonadeca-10,13-dien-2-one is sourced from PubChem (CID 155456381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).