About 1-(disulfanyl)-N,N-dimethylethenamine
1-(disulfanyl)-N,N-dimethylethenamine (PubChem CID 155456388) has the molecular formula C4H9NS2
and a molecular weight of 135.26 g/mol. Its IUPAC name is 1-(disulfanyl)-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | 1-(disulfanyl)-N,N-dimethylethenamine |
| PubChem CID | 155456388 |
| Molecular Formula | C4H9NS2 |
| Molecular Weight | 135.26 g/mol |
| Exact Mass | 135.02 |
| IUPAC Name | 1-(disulfanyl)-N,N-dimethylethenamine |
| SMILES | C=C(SS)N(C)C |
| InChI | InChI=1S/C4H9NS2/c1-4(7-6)5(2)3/h6H,1H2,2-3H3 |
| InChIKey | HNTVCOBCTQCJOE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(disulfanyl)-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(disulfanyl)-N,N-dimethylethenamine?
The IUPAC name of 1-(disulfanyl)-N,N-dimethylethenamine (CID 155456388) is 1-(disulfanyl)-N,N-dimethylethenamine.
What is the SMILES notation for 1-(disulfanyl)-N,N-dimethylethenamine?
The canonical SMILES for 1-(disulfanyl)-N,N-dimethylethenamine is C=C(SS)N(C)C.
What is the InChIKey of 1-(disulfanyl)-N,N-dimethylethenamine?
The InChIKey is HNTVCOBCTQCJOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NS2/c1-4(7-6)5(2)3/h6H,1H2,2-3H3.
What are the key properties of 1-(disulfanyl)-N,N-dimethylethenamine?
1-(disulfanyl)-N,N-dimethylethenamine has a molecular weight of 135.26 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(disulfanyl)-N,N-dimethylethenamine is sourced from PubChem (CID 155456388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).