About (E)-1-chloro-N-ethoxy-N'-[(Z)-ethylideneamino]-N-methylethene-1,2-diamine
(E)-1-chloro-N-ethoxy-N'-[(Z)-ethylideneamino]-N-methylethene-1,2-diamine (PubChem CID 155456681) has the molecular formula C7H14ClN3O
and a molecular weight of 191.66 g/mol. Its IUPAC name is (E)-1-chloro-N-ethoxy-N'-[(Z)-ethylideneamino]-N-methylethene-1,2-diamine.
Molecular Properties
| Compound Name | (E)-1-chloro-N-ethoxy-N'-[(Z)-ethylideneamino]-N-methylethene-1,2-diamine |
| PubChem CID | 155456681 |
| Molecular Formula | C7H14ClN3O |
| Molecular Weight | 191.66 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | (E)-1-chloro-N-ethoxy-N'-[(Z)-ethylideneamino]-N-methylethene-1,2-diamine |
| SMILES | C/C=N\N/C=C(/Cl)N(C)OCC |
| InChI | InChI=1S/C7H14ClN3O/c1-4-9-10-6-7(8)11(3)12-5-2/h4,6,10H,5H2,1-3H3/b7-6-,9-4- |
| InChIKey | LAIFLVBEHQXWFY-LDCOQZMTSA-N |
| XLogP | 1.50 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.66 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-chloro-N-ethoxy-N'-[(Z)-ethylideneamino]-N-methylethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-chloro-N-ethoxy-N'-[(Z)-ethylideneamino]-N-methylethene-1,2-diamine?
The IUPAC name of (E)-1-chloro-N-ethoxy-N'-[(Z)-ethylideneamino]-N-methylethene-1,2-diamine (CID 155456681) is (E)-1-chloro-N-ethoxy-N'-[(Z)-ethylideneamino]-N-methylethene-1,2-diamine.
What is the SMILES notation for (E)-1-chloro-N-ethoxy-N'-[(Z)-ethylideneamino]-N-methylethene-1,2-diamine?
The canonical SMILES for (E)-1-chloro-N-ethoxy-N'-[(Z)-ethylideneamino]-N-methylethene-1,2-diamine is C/C=N\N/C=C(/Cl)N(C)OCC.
What is the InChIKey of (E)-1-chloro-N-ethoxy-N'-[(Z)-ethylideneamino]-N-methylethene-1,2-diamine?
The InChIKey is LAIFLVBEHQXWFY-LDCOQZMTSA-N. The full InChI is InChI=1S/C7H14ClN3O/c1-4-9-10-6-7(8)11(3)12-5-2/h4,6,10H,5H2,1-3H3/b7-6-,9-4-.
What are the key properties of (E)-1-chloro-N-ethoxy-N'-[(Z)-ethylideneamino]-N-methylethene-1,2-diamine?
(E)-1-chloro-N-ethoxy-N'-[(Z)-ethylideneamino]-N-methylethene-1,2-diamine has a molecular weight of 191.66 g/mol, XLogP of 1.50, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-chloro-N-ethoxy-N'-[(Z)-ethylideneamino]-N-methylethene-1,2-diamine is sourced from PubChem (CID 155456681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).