About 5,5-difluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyridin-3-amine
5,5-difluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyridin-3-amine (PubChem CID 155456896) has the molecular formula C7H9F2N3
and a molecular weight of 173.17 g/mol. Its IUPAC name is 5,5-difluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 5,5-difluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyridin-3-amine |
| PubChem CID | 155456896 |
| Molecular Formula | C7H9F2N3 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 5,5-difluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyridin-3-amine |
| SMILES | Nc1cnn2c1CC(F)(F)CC2 |
| InChI | InChI=1S/C7H9F2N3/c8-7(9)1-2-12-6(3-7)5(10)4-11-12/h4H,1-3,10H2 |
| InChIKey | QXDQONSXGFHCKQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,5-difluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyridin-3-amine?
The IUPAC name of 5,5-difluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyridin-3-amine (CID 155456896) is 5,5-difluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyridin-3-amine.
What is the SMILES notation for 5,5-difluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyridin-3-amine?
The canonical SMILES for 5,5-difluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyridin-3-amine is Nc1cnn2c1CC(F)(F)CC2.
What is the InChIKey of 5,5-difluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyridin-3-amine?
The InChIKey is QXDQONSXGFHCKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F2N3/c8-7(9)1-2-12-6(3-7)5(10)4-11-12/h4H,1-3,10H2.
What are the key properties of 5,5-difluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyridin-3-amine?
5,5-difluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyridin-3-amine has a molecular weight of 173.17 g/mol, XLogP of 1.05, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoro-6,7-dihydro-4H-pyrazolo[1,5-a]pyridin-3-amine is sourced from PubChem (CID 155456896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).