C16H32N2O2 — CID 155458223
2-[[(2R)-3-methylbutan-2-yl]amino]-1-[4-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]ethanone (PubChem CID 155458223) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is 2-[[(2R)-3-methylbutan-2-yl]amino]-1-[4-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]ethanone.
| Compound Name | 2-[[(2R)-3-methylbutan-2-yl]amino]-1-[4-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 155458223 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 2-[[(2R)-3-methylbutan-2-yl]amino]-1-[4-[(2-methylpropan-2-yl)oxy]piperidin-1-yl]ethanone |
| SMILES | CC(C)[C@@H](C)NCC(=O)N1CCC(OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H32N2O2/c1-12(2)13(3)17-11-15(19)18-9-7-14(8-10-18)20-16(4,5)6/h12-14,17H,7-11H2,1-6H3/t13-/m1/s1 |
| InChIKey | UBRVRISELOALSC-CYBMUJFWSA-N |
| XLogP | 2.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |