About (2E,4Z)-4-methyl-1-methylimino-N-propylhexa-2,4-dien-3-amine
(2E,4Z)-4-methyl-1-methylimino-N-propylhexa-2,4-dien-3-amine (PubChem CID 155458854) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is (2E,4Z)-4-methyl-1-methylimino-N-propylhexa-2,4-dien-3-amine.
Molecular Properties
| Compound Name | (2E,4Z)-4-methyl-1-methylimino-N-propylhexa-2,4-dien-3-amine |
| PubChem CID | 155458854 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (2E,4Z)-4-methyl-1-methylimino-N-propylhexa-2,4-dien-3-amine |
| SMILES | C/C=C(C)\C(=C/C=N/C)NCCC |
| InChI | InChI=1S/C11H20N2/c1-5-8-13-11(7-9-12-4)10(3)6-2/h6-7,9,13H,5,8H2,1-4H3/b10-6-,11-7+,12-9+ |
| InChIKey | CJHIAHCSCNKRQC-RNDBMSTGSA-N |
| XLogP | 2.54 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-4-methyl-1-methylimino-N-propylhexa-2,4-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-4-methyl-1-methylimino-N-propylhexa-2,4-dien-3-amine?
The IUPAC name of (2E,4Z)-4-methyl-1-methylimino-N-propylhexa-2,4-dien-3-amine (CID 155458854) is (2E,4Z)-4-methyl-1-methylimino-N-propylhexa-2,4-dien-3-amine.
What is the SMILES notation for (2E,4Z)-4-methyl-1-methylimino-N-propylhexa-2,4-dien-3-amine?
The canonical SMILES for (2E,4Z)-4-methyl-1-methylimino-N-propylhexa-2,4-dien-3-amine is C/C=C(C)\C(=C/C=N/C)NCCC.
What is the InChIKey of (2E,4Z)-4-methyl-1-methylimino-N-propylhexa-2,4-dien-3-amine?
The InChIKey is CJHIAHCSCNKRQC-RNDBMSTGSA-N. The full InChI is InChI=1S/C11H20N2/c1-5-8-13-11(7-9-12-4)10(3)6-2/h6-7,9,13H,5,8H2,1-4H3/b10-6-,11-7+,12-9+.
What are the key properties of (2E,4Z)-4-methyl-1-methylimino-N-propylhexa-2,4-dien-3-amine?
(2E,4Z)-4-methyl-1-methylimino-N-propylhexa-2,4-dien-3-amine has a molecular weight of 180.29 g/mol, XLogP of 2.54, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-4-methyl-1-methylimino-N-propylhexa-2,4-dien-3-amine is sourced from PubChem (CID 155458854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).