C26H23Cl4N5O — CID 155458998
N-[2,3-bis(3,4-dichloroanilino)quinoxalin-6-yl]hexanamide (PubChem CID 155458998) has the molecular formula C26H23Cl4N5O and a molecular weight of 563.32 g/mol. Its IUPAC name is N-[2,3-bis(3,4-dichloroanilino)quinoxalin-6-yl]hexanamide.
| Compound Name | N-[2,3-bis(3,4-dichloroanilino)quinoxalin-6-yl]hexanamide |
|---|---|
| PubChem CID | 155458998 |
| Molecular Formula | C26H23Cl4N5O |
| Molecular Weight | 563.32 g/mol |
| Exact Mass | 561.07 |
| IUPAC Name | N-[2,3-bis(3,4-dichloroanilino)quinoxalin-6-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc2nc(Nc3ccc(Cl)c(Cl)c3)c(Nc3ccc(Cl)c(Cl)c3)nc2c1 |
| InChI | InChI=1S/C26H23Cl4N5O/c1-2-3-4-5-24(36)31-17-8-11-22-23(14-17)35-26(33-16-7-10-19(28)21(30)13-16)25(34-22)32-15-6-9-18(27)20(29)12-15/h6-14H,2-5H2,1H3,(H,31,36)(H,32,34)(H,33,35) |
| InChIKey | QJSDYSJRIHOVEJ-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.32 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|