C11H13NS — CID 155459267
3,8-dimethyl-4,9-dimethylidene-1,5-thiazonine (PubChem CID 155459267) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is 3,8-dimethyl-4,9-dimethylidene-1,5-thiazonine.
| Compound Name | 3,8-dimethyl-4,9-dimethylidene-1,5-thiazonine |
|---|---|
| PubChem CID | 155459267 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 3,8-dimethyl-4,9-dimethylidene-1,5-thiazonine |
| SMILES | C=c1nccc(C)c(=C)scc1C |
| InChI | InChI=1S/C11H13NS/c1-8-5-6-12-10(3)9(2)7-13-11(8)4/h5-7H,3-4H2,1-2H3/b8-5-,9-7-,12-6- |
| InChIKey | RTMAHSUWZIJLDD-YPLYZRRISA-N |
| XLogP | 1.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |