About 2-methoxy-1-(3-methylcyclohexa-1,5-dien-1-yl)ethanol
2-methoxy-1-(3-methylcyclohexa-1,5-dien-1-yl)ethanol (PubChem CID 155459470) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-methoxy-1-(3-methylcyclohexa-1,5-dien-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-methoxy-1-(3-methylcyclohexa-1,5-dien-1-yl)ethanol |
| PubChem CID | 155459470 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2-methoxy-1-(3-methylcyclohexa-1,5-dien-1-yl)ethanol |
| SMILES | COCC(O)C1=CC(C)CC=C1 |
| InChI | InChI=1S/C10H16O2/c1-8-4-3-5-9(6-8)10(11)7-12-2/h3,5-6,8,10-11H,4,7H2,1-2H3 |
| InChIKey | NIZXINAPFZPZQA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-1-(3-methylcyclohexa-1,5-dien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1-(3-methylcyclohexa-1,5-dien-1-yl)ethanol?
The IUPAC name of 2-methoxy-1-(3-methylcyclohexa-1,5-dien-1-yl)ethanol (CID 155459470) is 2-methoxy-1-(3-methylcyclohexa-1,5-dien-1-yl)ethanol.
What is the SMILES notation for 2-methoxy-1-(3-methylcyclohexa-1,5-dien-1-yl)ethanol?
The canonical SMILES for 2-methoxy-1-(3-methylcyclohexa-1,5-dien-1-yl)ethanol is COCC(O)C1=CC(C)CC=C1.
What is the InChIKey of 2-methoxy-1-(3-methylcyclohexa-1,5-dien-1-yl)ethanol?
The InChIKey is NIZXINAPFZPZQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-8-4-3-5-9(6-8)10(11)7-12-2/h3,5-6,8,10-11H,4,7H2,1-2H3.
What are the key properties of 2-methoxy-1-(3-methylcyclohexa-1,5-dien-1-yl)ethanol?
2-methoxy-1-(3-methylcyclohexa-1,5-dien-1-yl)ethanol has a molecular weight of 168.24 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1-(3-methylcyclohexa-1,5-dien-1-yl)ethanol is sourced from PubChem (CID 155459470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).