C12H20O2S — CID 155459613
5,7-diethyl-2,3,4a,5,7,9a-hexahydrothiepino[3,4-b][1,4]dioxine (PubChem CID 155459613) has the molecular formula C12H20O2S and a molecular weight of 228.36 g/mol. Its IUPAC name is 5,7-diethyl-2,3,4a,5,7,9a-hexahydrothiepino[3,4-b][1,4]dioxine.
| Compound Name | 5,7-diethyl-2,3,4a,5,7,9a-hexahydrothiepino[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 155459613 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 5,7-diethyl-2,3,4a,5,7,9a-hexahydrothiepino[3,4-b][1,4]dioxine |
| SMILES | CCC1C=CC2OCCOC2C(CC)S1 |
| InChI | InChI=1S/C12H20O2S/c1-3-9-5-6-10-12(11(4-2)15-9)14-8-7-13-10/h5-6,9-12H,3-4,7-8H2,1-2H3 |
| InChIKey | BCDGRVKECCOPJB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|