C11H22N2 — CID 155459680
1,3,5-triethyl-4,7-dihydro-2H-1,3-diazepine (PubChem CID 155459680) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 1,3,5-triethyl-4,7-dihydro-2H-1,3-diazepine.
| Compound Name | 1,3,5-triethyl-4,7-dihydro-2H-1,3-diazepine |
|---|---|
| PubChem CID | 155459680 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1,3,5-triethyl-4,7-dihydro-2H-1,3-diazepine |
| SMILES | CCC1=CCN(CC)CN(CC)C1 |
| InChI | InChI=1S/C11H22N2/c1-4-11-7-8-12(5-2)10-13(6-3)9-11/h7H,4-6,8-10H2,1-3H3 |
| InChIKey | NWPJFGNILSSVOQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|