C28H27FN4O2S — CID 155460195
(7S)-12-(2-fluoro-6-hydroxyphenyl)-15-(2-propan-2-ylphenyl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraene-16-thione (PubChem CID 155460195) has the molecular formula C28H27FN4O2S and a molecular weight of 502.62 g/mol. Its IUPAC name is (7S)-12-(2-fluoro-6-hydroxyphenyl)-15-(2-propan-2-ylphenyl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraene-16-thione.
| Compound Name | (7S)-12-(2-fluoro-6-hydroxyphenyl)-15-(2-propan-2-ylphenyl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraene-16-thione |
|---|---|
| PubChem CID | 155460195 |
| Molecular Formula | C28H27FN4O2S |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | (7S)-12-(2-fluoro-6-hydroxyphenyl)-15-(2-propan-2-ylphenyl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraene-16-thione |
| SMILES | CC(C)c1ccccc1-n1c(=S)nc2c3c(cc(-c4c(O)cccc4F)cc31)OC[C@@H]1CNCCN21 |
| InChI | InChI=1S/C28H27FN4O2S/c1-16(2)19-6-3-4-8-21(19)33-22-12-17(25-20(29)7-5-9-23(25)34)13-24-26(22)27(31-28(33)36)32-11-10-30-14-18(32)15-35-24/h3-9,12-13,16,18,30,34H,10-11,14-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | JVTQFYINNXZXLX-SFHVURJKSA-N |
| XLogP | 5.56 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|