C31H29FN4O3S — CID 155460223
1-[(7S)-12-(2-fluoro-6-hydroxyphenyl)-15-(2-propan-2-ylphenyl)-16-sulfanylidene-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-5-yl]prop-2-en-1-one (PubChem CID 155460223) has the molecular formula C31H29FN4O3S and a molecular weight of 556.66 g/mol. Its IUPAC name is 1-[(7S)-12-(2-fluoro-6-hydroxyphenyl)-15-(2-propan-2-ylphenyl)-16-sulfanylidene-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-5-yl]prop-2-en-1-one.
| Compound Name | 1-[(7S)-12-(2-fluoro-6-hydroxyphenyl)-15-(2-propan-2-ylphenyl)-16-sulfanylidene-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155460223 |
| Molecular Formula | C31H29FN4O3S |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 1-[(7S)-12-(2-fluoro-6-hydroxyphenyl)-15-(2-propan-2-ylphenyl)-16-sulfanylidene-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN2c3nc(=S)n(-c4ccccc4C(C)C)c4cc(-c5c(O)cccc5F)cc(c34)OC[C@@H]2C1 |
| InChI | InChI=1S/C31H29FN4O3S/c1-4-27(38)34-12-13-35-20(16-34)17-39-26-15-19(28-22(32)9-7-11-25(28)37)14-24-29(26)30(35)33-31(40)36(24)23-10-6-5-8-21(23)18(2)3/h4-11,14-15,18,20,37H,1,12-13,16-17H2,2-3H3/t20-/m0/s1 |
| InChIKey | OBJGPCUWCXQXSJ-FQEVSTJZSA-N |
| XLogP | 5.99 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|