C32H34FN7O3 — CID 155460225
(7S)-12-(2-amino-6-fluorophenyl)-15-[4,6-di(propan-2-yl)pyrimidin-5-yl]-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one (PubChem CID 155460225) has the molecular formula C32H34FN7O3 and a molecular weight of 583.67 g/mol. Its IUPAC name is (7S)-12-(2-amino-6-fluorophenyl)-15-[4,6-di(propan-2-yl)pyrimidin-5-yl]-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one.
| Compound Name | (7S)-12-(2-amino-6-fluorophenyl)-15-[4,6-di(propan-2-yl)pyrimidin-5-yl]-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
|---|---|
| PubChem CID | 155460225 |
| Molecular Formula | C32H34FN7O3 |
| Molecular Weight | 583.67 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | (7S)-12-(2-amino-6-fluorophenyl)-15-[4,6-di(propan-2-yl)pyrimidin-5-yl]-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
| SMILES | C=CC(=O)N1CCN2c3nc(=O)n(-c4c(C(C)C)ncnc4C(C)C)c4cc(-c5c(N)cccc5F)cc(c34)OC[C@@H]2C1 |
| InChI | InChI=1S/C32H34FN7O3/c1-6-25(41)38-10-11-39-20(14-38)15-43-24-13-19(26-21(33)8-7-9-22(26)34)12-23-27(24)31(39)37-32(42)40(23)30-28(17(2)3)35-16-36-29(30)18(4)5/h6-9,12-13,16-18,20H,1,10-11,14-15,34H2,2-5H3/t20-/m0/s1 |
| InChIKey | FNQHVTFYEIVDAB-FQEVSTJZSA-N |
| XLogP | 4.41 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|