C29H32FN7O2 — CID 155460227
(7S)-12-(2-amino-6-fluorophenyl)-15-[4,6-di(propan-2-yl)pyrimidin-5-yl]-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one (PubChem CID 155460227) has the molecular formula C29H32FN7O2 and a molecular weight of 529.62 g/mol. Its IUPAC name is (7S)-12-(2-amino-6-fluorophenyl)-15-[4,6-di(propan-2-yl)pyrimidin-5-yl]-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one.
| Compound Name | (7S)-12-(2-amino-6-fluorophenyl)-15-[4,6-di(propan-2-yl)pyrimidin-5-yl]-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
|---|---|
| PubChem CID | 155460227 |
| Molecular Formula | C29H32FN7O2 |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | (7S)-12-(2-amino-6-fluorophenyl)-15-[4,6-di(propan-2-yl)pyrimidin-5-yl]-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
| SMILES | CC(C)c1ncnc(C(C)C)c1-n1c(=O)nc2c3c(cc(-c4c(N)cccc4F)cc31)OC[C@@H]1CNCCN21 |
| InChI | InChI=1S/C29H32FN7O2/c1-15(2)25-27(26(16(3)4)34-14-33-25)37-21-10-17(23-19(30)6-5-7-20(23)31)11-22-24(21)28(35-29(37)38)36-9-8-32-12-18(36)13-39-22/h5-7,10-11,14-16,18,32H,8-9,12-13,31H2,1-4H3/t18-/m0/s1 |
| InChIKey | MSFLPFALKQQAHE-SFHVURJKSA-N |
| XLogP | 3.98 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|