C27H25FN4O4 — CID 155460230
(4R,7S)-15-[(1E)-buta-1,3-dienyl]-12-(2-fluoro-6-hydroxyphenyl)-4-methyl-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one (PubChem CID 155460230) has the molecular formula C27H25FN4O4 and a molecular weight of 488.52 g/mol. Its IUPAC name is (4R,7S)-15-[(1E)-buta-1,3-dienyl]-12-(2-fluoro-6-hydroxyphenyl)-4-methyl-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one.
| Compound Name | (4R,7S)-15-[(1E)-buta-1,3-dienyl]-12-(2-fluoro-6-hydroxyphenyl)-4-methyl-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
|---|---|
| PubChem CID | 155460230 |
| Molecular Formula | C27H25FN4O4 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | (4R,7S)-15-[(1E)-buta-1,3-dienyl]-12-(2-fluoro-6-hydroxyphenyl)-4-methyl-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
| SMILES | C=C/C=C/n1c(=O)nc2c3c(cc(-c4c(O)cccc4F)cc31)OC[C@@H]1CN(C(=O)C=C)[C@H](C)CN21 |
| InChI | InChI=1S/C27H25FN4O4/c1-4-6-10-30-20-11-17(24-19(28)8-7-9-21(24)33)12-22-25(20)26(29-27(30)35)32-13-16(3)31(23(34)5-2)14-18(32)15-36-22/h4-12,16,18,33H,1-2,13-15H2,3H3/b10-6+/t16-,18+/m1/s1 |
| InChIKey | NOGLRDWBHHRUBR-KVGCROTGSA-N |
| XLogP | 3.55 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|