C32H31FN4O4 — CID 155460232
(4S,7S)-12-(2-fluoro-6-hydroxyphenyl)-4-methyl-15-(2-propan-2-ylphenyl)-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one (PubChem CID 155460232) has the molecular formula C32H31FN4O4 and a molecular weight of 554.62 g/mol. Its IUPAC name is (4S,7S)-12-(2-fluoro-6-hydroxyphenyl)-4-methyl-15-(2-propan-2-ylphenyl)-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one.
| Compound Name | (4S,7S)-12-(2-fluoro-6-hydroxyphenyl)-4-methyl-15-(2-propan-2-ylphenyl)-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
|---|---|
| PubChem CID | 155460232 |
| Molecular Formula | C32H31FN4O4 |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | (4S,7S)-12-(2-fluoro-6-hydroxyphenyl)-4-methyl-15-(2-propan-2-ylphenyl)-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
| SMILES | C=CC(=O)N1C[C@H]2COc3cc(-c4c(O)cccc4F)cc4c3c(nc(=O)n4-c3ccccc3C(C)C)N2C[C@@H]1C |
| InChI | InChI=1S/C32H31FN4O4/c1-5-28(39)35-16-21-17-41-27-14-20(29-23(33)10-8-12-26(29)38)13-25-30(27)31(36(21)15-19(35)4)34-32(40)37(25)24-11-7-6-9-22(24)18(2)3/h5-14,18-19,21,38H,1,15-17H2,2-4H3/t19-,21-/m0/s1 |
| InChIKey | IFBKMDRRCONVGJ-FPOVZHCZSA-N |
| XLogP | 5.00 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|