C14H25F3O7SSi — CID 15546092
methyl (2R,3R,4S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-(trifluoromethylsulfonyloxy)oxetane-2-carboxylate (PubChem CID 15546092) has the molecular formula C14H25F3O7SSi and a molecular weight of 422.49 g/mol. Its IUPAC name is methyl (2R,3R,4S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-(trifluoromethylsulfonyloxy)oxetane-2-carboxylate.
| Compound Name | methyl (2R,3R,4S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-(trifluoromethylsulfonyloxy)oxetane-2-carboxylate |
|---|---|
| PubChem CID | 15546092 |
| Molecular Formula | C14H25F3O7SSi |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | methyl (2R,3R,4S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-(trifluoromethylsulfonyloxy)oxetane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@@H]([C@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H25F3O7SSi/c1-8(24-26(6,7)13(2,3)4)9-10(11(22-9)12(18)21-5)23-25(19,20)14(15,16)17/h8-11H,1-7H3/t8-,9-,10+,11+/m0/s1 |
| InChIKey | AKCRZHSDDKEGFX-UKKRHICBSA-N |
| XLogP | 2.57 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|