About tert-butyl 5,6-difluoro-3-(2-methoxy-2-oxoethyl)-3-methyl-2H-indole-1-carboxylate
tert-butyl 5,6-difluoro-3-(2-methoxy-2-oxoethyl)-3-methyl-2H-indole-1-carboxylate (PubChem CID 155462184) has the molecular formula C17H21F2NO4
and a molecular weight of 341.35 g/mol. Its IUPAC name is tert-butyl 5,6-difluoro-3-(2-methoxy-2-oxoethyl)-3-methyl-2H-indole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 5,6-difluoro-3-(2-methoxy-2-oxoethyl)-3-methyl-2H-indole-1-carboxylate |
| PubChem CID | 155462184 |
| Molecular Formula | C17H21F2NO4 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | tert-butyl 5,6-difluoro-3-(2-methoxy-2-oxoethyl)-3-methyl-2H-indole-1-carboxylate |
| SMILES | COC(=O)CC1(C)CN(C(=O)OC(C)(C)C)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C17H21F2NO4/c1-16(2,3)24-15(22)20-9-17(4,8-14(21)23-5)10-6-11(18)12(19)7-13(10)20/h6-7H,8-9H2,1-5H3 |
| InChIKey | YUEBLVAMYJHKGE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 5,6-difluoro-3-(2-methoxy-2-oxoethyl)-3-methyl-2H-indole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5,6-difluoro-3-(2-methoxy-2-oxoethyl)-3-methyl-2H-indole-1-carboxylate?
The IUPAC name of tert-butyl 5,6-difluoro-3-(2-methoxy-2-oxoethyl)-3-methyl-2H-indole-1-carboxylate (CID 155462184) is tert-butyl 5,6-difluoro-3-(2-methoxy-2-oxoethyl)-3-methyl-2H-indole-1-carboxylate.
What is the SMILES notation for tert-butyl 5,6-difluoro-3-(2-methoxy-2-oxoethyl)-3-methyl-2H-indole-1-carboxylate?
The canonical SMILES for tert-butyl 5,6-difluoro-3-(2-methoxy-2-oxoethyl)-3-methyl-2H-indole-1-carboxylate is COC(=O)CC1(C)CN(C(=O)OC(C)(C)C)c2cc(F)c(F)cc21.
What is the InChIKey of tert-butyl 5,6-difluoro-3-(2-methoxy-2-oxoethyl)-3-methyl-2H-indole-1-carboxylate?
The InChIKey is YUEBLVAMYJHKGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2NO4/c1-16(2,3)24-15(22)20-9-17(4,8-14(21)23-5)10-6-11(18)12(19)7-13(10)20/h6-7H,8-9H2,1-5H3.
What are the key properties of tert-butyl 5,6-difluoro-3-(2-methoxy-2-oxoethyl)-3-methyl-2H-indole-1-carboxylate?
tert-butyl 5,6-difluoro-3-(2-methoxy-2-oxoethyl)-3-methyl-2H-indole-1-carboxylate has a molecular weight of 341.35 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5,6-difluoro-3-(2-methoxy-2-oxoethyl)-3-methyl-2H-indole-1-carboxylate is sourced from PubChem (CID 155462184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).