C21H34N2O2 — CID 155463373
3-[(2R,3R)-1-(butoxymethyl)-2,3,4-trimethylpiperidin-4-yl]-4-methylbenzamide (PubChem CID 155463373) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 3-[(2R,3R)-1-(butoxymethyl)-2,3,4-trimethylpiperidin-4-yl]-4-methylbenzamide.
| Compound Name | 3-[(2R,3R)-1-(butoxymethyl)-2,3,4-trimethylpiperidin-4-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 155463373 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | 3-[(2R,3R)-1-(butoxymethyl)-2,3,4-trimethylpiperidin-4-yl]-4-methylbenzamide |
| SMILES | CCCCOCN1CCC(C)(c2cc(C(N)=O)ccc2C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C21H34N2O2/c1-6-7-12-25-14-23-11-10-21(5,16(3)17(23)4)19-13-18(20(22)24)9-8-15(19)2/h8-9,13,16-17H,6-7,10-12,14H2,1-5H3,(H2,22,24)/t16-,17+,21?/m0/s1 |
| InChIKey | JMWYSMVBGQMSGZ-NXRUOVBSSA-N |
| XLogP | 3.86 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|