C18H22BrClN4O — CID 155463496
2-[2-bromo-5-[[5-chloro-4-(cyclopentylamino)pyrimidin-2-yl]amino]phenyl]propan-2-ol (PubChem CID 155463496) has the molecular formula C18H22BrClN4O and a molecular weight of 425.76 g/mol. Its IUPAC name is 2-[2-bromo-5-[[5-chloro-4-(cyclopentylamino)pyrimidin-2-yl]amino]phenyl]propan-2-ol.
| Compound Name | 2-[2-bromo-5-[[5-chloro-4-(cyclopentylamino)pyrimidin-2-yl]amino]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 155463496 |
| Molecular Formula | C18H22BrClN4O |
| Molecular Weight | 425.76 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 2-[2-bromo-5-[[5-chloro-4-(cyclopentylamino)pyrimidin-2-yl]amino]phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1cc(Nc2ncc(Cl)c(NC3CCCC3)n2)ccc1Br |
| InChI | InChI=1S/C18H22BrClN4O/c1-18(2,25)13-9-12(7-8-14(13)19)23-17-21-10-15(20)16(24-17)22-11-5-3-4-6-11/h7-11,25H,3-6H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | SOUZGPZTHVHXQB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.76 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |