C32H40N2O — CID 155464016
6-[3-[3-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]-2-methylphenyl]-2-methylphenyl]-1,2,3,4-tetrahydroisoquinoline (PubChem CID 155464016) has the molecular formula C32H40N2O and a molecular weight of 468.69 g/mol. Its IUPAC name is 6-[3-[3-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]-2-methylphenyl]-2-methylphenyl]-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 6-[3-[3-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]-2-methylphenyl]-2-methylphenyl]-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 155464016 |
| Molecular Formula | C32H40N2O |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | 6-[3-[3-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]-2-methylphenyl]-2-methylphenyl]-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Cc1c(OCCCN2[C@H](C)CC[C@H]2C)cccc1-c1cccc(-c2ccc3c(c2)CCNC3)c1C |
| InChI | InChI=1S/C32H40N2O/c1-22-12-13-23(2)34(22)18-7-19-35-32-11-6-10-31(25(32)4)30-9-5-8-29(24(30)3)27-14-15-28-21-33-17-16-26(28)20-27/h5-6,8-11,14-15,20,22-23,33H,7,12-13,16-19,21H2,1-4H3/t22-,23-/m1/s1 |
| InChIKey | DAZLPZNIGJNWEV-DHIUTWEWSA-N |
| XLogP | 6.92 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|