C23H17F3N2O4 — CID 155464371
N-(1,6-dimethyl-9H-xanthen-9-yl)-5-formyl-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 155464371) has the molecular formula C23H17F3N2O4 and a molecular weight of 442.39 g/mol. Its IUPAC name is N-(1,6-dimethyl-9H-xanthen-9-yl)-5-formyl-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-(1,6-dimethyl-9H-xanthen-9-yl)-5-formyl-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155464371 |
| Molecular Formula | C23H17F3N2O4 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-(1,6-dimethyl-9H-xanthen-9-yl)-5-formyl-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | Cc1ccc2c(c1)Oc1cccc(C)c1C2NC(=O)c1cc(C=O)c(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C23H17F3N2O4/c1-11-6-7-14-17(8-11)32-16-5-3-4-12(2)18(16)19(14)27-21(30)15-9-13(10-29)20(23(24,25)26)28-22(15)31/h3-10,19H,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | NWIUSRWNOPUYMJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|